C17H22N2O3S — CID 123481456
N,7-dimethyl-6-(4-methyloxan-4-yl)sulfonylquinolin-4-amine (PubChem CID 123481456) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N,7-dimethyl-6-(4-methyloxan-4-yl)sulfonylquinolin-4-amine.
| Compound Name | N,7-dimethyl-6-(4-methyloxan-4-yl)sulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 123481456 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N,7-dimethyl-6-(4-methyloxan-4-yl)sulfonylquinolin-4-amine |
| SMILES | CNc1ccnc2cc(C)c(S(=O)(=O)C3(C)CCOCC3)cc12 |
| InChI | InChI=1S/C17H22N2O3S/c1-12-10-15-13(14(18-3)4-7-19-15)11-16(12)23(20,21)17(2)5-8-22-9-6-17/h4,7,10-11H,5-6,8-9H2,1-3H3,(H,18,19) |
| InChIKey | AXMOFGSLFCLOCP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |