C47H81N3O2 — CID 123501964
(3aR,7aS)-5-[2-(1H-imidazol-5-yl)ethyl]-2,2-bis(octadeca-9,12-dienyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 123501964) has the molecular formula C47H81N3O2 and a molecular weight of 720.18 g/mol. Its IUPAC name is (3aR,7aS)-5-[2-(1H-imidazol-5-yl)ethyl]-2,2-bis(octadeca-9,12-dienyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | (3aR,7aS)-5-[2-(1H-imidazol-5-yl)ethyl]-2,2-bis(octadeca-9,12-dienyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 123501964 |
| Molecular Formula | C47H81N3O2 |
| Molecular Weight | 720.18 g/mol |
| Exact Mass | 719.63 |
| IUPAC Name | (3aR,7aS)-5-[2-(1H-imidazol-5-yl)ethyl]-2,2-bis(octadeca-9,12-dienyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)O[C@H]2CCN(CCc3cnc[nH]3)C[C@H]2O1 |
| InChI | InChI=1S/C47H81N3O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-47(38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)51-45-36-40-50(42-46(45)52-47)39-35-44-41-48-43-49-44/h11-14,17-20,41,43,45-46H,3-10,15-16,21-40,42H2,1-2H3,(H,48,49)/t45-,46+,47?/m0/s1 |
| InChIKey | RUUNSYQSAADYRQ-CROYFHLWSA-N |
| XLogP | 13.55 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.18 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|