C48H85N3O2 — CID 67475975
N-[2-(1H-imidazol-5-yl)ethyl]-N-methyl-2-[(4S)-2-[(9Z,12Z)-nonadeca-9,12-dienyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanamine (PubChem CID 67475975) has the molecular formula C48H85N3O2 and a molecular weight of 736.23 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-N-methyl-2-[(4S)-2-[(9Z,12Z)-nonadeca-9,12-dienyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanamine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-N-methyl-2-[(4S)-2-[(9Z,12Z)-nonadeca-9,12-dienyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanamine |
|---|---|
| PubChem CID | 67475975 |
| Molecular Formula | C48H85N3O2 |
| Molecular Weight | 736.23 g/mol |
| Exact Mass | 735.66 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-N-methyl-2-[(4S)-2-[(9Z,12Z)-nonadeca-9,12-dienyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCCC)OC[C@H](CCN(C)CCc2cnc[nH]2)O1 |
| InChI | InChI=1S/C48H85N3O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-48(52-44-47(53-48)38-42-51(3)41-37-46-43-49-45-50-46)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h13-16,19-22,43,45,47H,4-12,17-18,23-42,44H2,1-3H3,(H,49,50)/b15-13-,16-14-,21-19-,22-20-/t47-,48?/m0/s1 |
| InChIKey | WARFCFXJZWHTNY-PGHIMOLVSA-N |
| XLogP | 14.18 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.23 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|