C47H83N3O2 — CID 58069519
2-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-N-methylethanamine (PubChem CID 58069519) has the molecular formula C47H83N3O2 and a molecular weight of 722.20 g/mol. Its IUPAC name is 2-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-N-methylethanamine.
| Compound Name | 2-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-N-methylethanamine |
|---|---|
| PubChem CID | 58069519 |
| Molecular Formula | C47H83N3O2 |
| Molecular Weight | 722.20 g/mol |
| Exact Mass | 721.65 |
| IUPAC Name | 2-[(4S)-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-[2-(1H-imidazol-5-yl)ethyl]-N-methylethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC[C@H](CCN(C)CCc2cnc[nH]2)O1 |
| InChI | InChI=1S/C47H83N3O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-47(51-43-46(52-47)37-41-50(3)40-36-45-42-48-44-49-45)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,42,44,46H,4-11,16-17,22-41,43H2,1-3H3,(H,48,49)/b14-12-,15-13-,20-18-,21-19-/t46-/m0/s1 |
| InChIKey | JDXFAYJMLXPJQR-MIGCPYABSA-N |
| XLogP | 13.79 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.20 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|