C28H33N5O — CID 123502871
4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-N-[2-(dimethylamino)ethyl]-N,3-dimethylbenzamide (PubChem CID 123502871) has the molecular formula C28H33N5O and a molecular weight of 455.61 g/mol. Its IUPAC name is 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-N-[2-(dimethylamino)ethyl]-N,3-dimethylbenzamide.
| Compound Name | 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-N-[2-(dimethylamino)ethyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 123502871 |
| Molecular Formula | C28H33N5O |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]-N-[2-(dimethylamino)ethyl]-N,3-dimethylbenzamide |
| SMILES | Cc1ccc2c(c1)nc(N)c1nccc(CCc3ccc(C(=O)N(C)CCN(C)C)cc3C)c12 |
| InChI | InChI=1S/C28H33N5O/c1-18-6-11-23-24(16-18)31-27(29)26-25(23)21(12-13-30-26)9-7-20-8-10-22(17-19(20)2)28(34)33(5)15-14-32(3)4/h6,8,10-13,16-17H,7,9,14-15H2,1-5H3,(H2,29,31) |
| InChIKey | JVDOIXPYKIVNAH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|