C27H29F3N6O — CID 123524262
N-[3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-fluoropyrimidin-4-yl]-difluoromethyl]phenyl]but-2-enamide (PubChem CID 123524262) has the molecular formula C27H29F3N6O and a molecular weight of 510.56 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-fluoropyrimidin-4-yl]-difluoromethyl]phenyl]but-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-fluoropyrimidin-4-yl]-difluoromethyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 123524262 |
| Molecular Formula | C27H29F3N6O |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | N-[3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-fluoropyrimidin-4-yl]-difluoromethyl]phenyl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1cccc(C(F)(F)c2nc(Nc3ccc(N4CCN(CC)CC4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C27H29F3N6O/c1-3-6-24(37)32-21-8-5-7-19(17-21)27(29,30)25-23(28)18-31-26(34-25)33-20-9-11-22(12-10-20)36-15-13-35(4-2)14-16-36/h3,5-12,17-18H,4,13-16H2,1-2H3,(H,32,37)(H,31,33,34) |
| InChIKey | CEAMKMUJWDZLOY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|