C29H31F2N7O2 — CID 78140922
N-[3-[difluoro-[7-(hydroxymethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-4-yl]methyl]phenyl]but-2-enamide (PubChem CID 78140922) has the molecular formula C29H31F2N7O2 and a molecular weight of 547.61 g/mol. Its IUPAC name is N-[3-[difluoro-[7-(hydroxymethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-4-yl]methyl]phenyl]but-2-enamide.
| Compound Name | N-[3-[difluoro-[7-(hydroxymethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-4-yl]methyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 78140922 |
| Molecular Formula | C29H31F2N7O2 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | N-[3-[difluoro-[7-(hydroxymethyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-4-yl]methyl]phenyl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1cccc(C(F)(F)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc3c2ccn3CO)c1 |
| InChI | InChI=1S/C29H31F2N7O2/c1-3-5-25(40)32-22-7-4-6-20(18-22)29(30,31)26-24-12-13-38(19-39)27(24)35-28(34-26)33-21-8-10-23(11-9-21)37-16-14-36(2)15-17-37/h3-13,18,39H,14-17,19H2,1-2H3,(H,32,40)(H,33,34,35) |
| InChIKey | YMAPODDOXDITOE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|