C3H8N4 — CID 123534053
2-methyl-1,3-dihydro-1,2,4-triazol-3-amine (PubChem CID 123534053) has the molecular formula C3H8N4 and a molecular weight of 100.12 g/mol. Its IUPAC name is 2-methyl-1,3-dihydro-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-1,3-dihydro-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123534053 |
| Molecular Formula | C3H8N4 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | 2-methyl-1,3-dihydro-1,2,4-triazol-3-amine |
| SMILES | CN1NC=NC1N |
| InChI | InChI=1S/C3H8N4/c1-7-3(4)5-2-6-7/h2-3H,4H2,1H3,(H,5,6) |
| InChIKey | ITICEAWKGNLLPP-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |