C5H11N3 — CID 144761164
2-methyl-4,5-dihydro-3H-pyridazin-4-amine (PubChem CID 144761164) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-3H-pyridazin-4-amine.
| Compound Name | 2-methyl-4,5-dihydro-3H-pyridazin-4-amine |
|---|---|
| PubChem CID | 144761164 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2-methyl-4,5-dihydro-3H-pyridazin-4-amine |
| SMILES | CN1CC(N)CC=N1 |
| InChI | InChI=1S/C5H11N3/c1-8-4-5(6)2-3-7-8/h3,5H,2,4,6H2,1H3 |
| InChIKey | APVNRVUJDFHBDN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |