C16H22N2 — CID 123536935
tetracyclo[8.3.2.18,11.02,7]hexadeca-2,4,6-triene-4,5-diamine (PubChem CID 123536935) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is tetracyclo[8.3.2.18,11.02,7]hexadeca-2,4,6-triene-4,5-diamine.
| Compound Name | tetracyclo[8.3.2.18,11.02,7]hexadeca-2,4,6-triene-4,5-diamine |
|---|---|
| PubChem CID | 123536935 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | tetracyclo[8.3.2.18,11.02,7]hexadeca-2,4,6-triene-4,5-diamine |
| SMILES | Nc1cc2c(cc1N)C1CC3CCC2CCC3C1 |
| InChI | InChI=1S/C16H22N2/c17-15-7-13-9-1-3-10-5-12(6-11(10)4-2-9)14(13)8-16(15)18/h7-12H,1-6,17-18H2 |
| InChIKey | SDEKVOYBMRLFSZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|