C12H15ClN2O2S — CID 123539160
5-chloro-N,3-diethyl-1H-indole-2-sulfonamide (PubChem CID 123539160) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 5-chloro-N,3-diethyl-1H-indole-2-sulfonamide.
| Compound Name | 5-chloro-N,3-diethyl-1H-indole-2-sulfonamide |
|---|---|
| PubChem CID | 123539160 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-chloro-N,3-diethyl-1H-indole-2-sulfonamide |
| SMILES | CCNS(=O)(=O)c1[nH]c2ccc(Cl)cc2c1CC |
| InChI | InChI=1S/C12H15ClN2O2S/c1-3-9-10-7-8(13)5-6-11(10)15-12(9)18(16,17)14-4-2/h5-7,14-15H,3-4H2,1-2H3 |
| InChIKey | AWRQXFDPHWNPTE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |