C18H28O9Si — CID 123539821
[2,3-diacetyloxy-3-(6-methyl-6-methylsilyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate (PubChem CID 123539821) has the molecular formula C18H28O9Si and a molecular weight of 416.50 g/mol. Its IUPAC name is [2,3-diacetyloxy-3-(6-methyl-6-methylsilyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate.
| Compound Name | [2,3-diacetyloxy-3-(6-methyl-6-methylsilyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate |
|---|---|
| PubChem CID | 123539821 |
| Molecular Formula | C18H28O9Si |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [2,3-diacetyloxy-3-(6-methyl-6-methylsilyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-yl)propyl] acetate |
| SMILES | C[SiH2]C1(C)CC2OC(=O)CC2C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C18H28O9Si/c1-9(19)23-8-14(24-10(2)20)17(25-11(3)21)16-12-6-15(22)26-13(12)7-18(4,27-16)28-5/h12-14,16-17H,6-8,28H2,1-5H3 |
| InChIKey | VKLYRDZRWPDXGT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|