C33H37N5O3 — CID 123560184
2-(2-methoxy-4-morpholin-4-ylanilino)-4-[3-[2-[2-(2-oxobut-3-enyl)cyclobutyl]phenyl]propyl]pyrimidine-5-carbonitrile (PubChem CID 123560184) has the molecular formula C33H37N5O3 and a molecular weight of 551.69 g/mol. Its IUPAC name is 2-(2-methoxy-4-morpholin-4-ylanilino)-4-[3-[2-[2-(2-oxobut-3-enyl)cyclobutyl]phenyl]propyl]pyrimidine-5-carbonitrile.
| Compound Name | 2-(2-methoxy-4-morpholin-4-ylanilino)-4-[3-[2-[2-(2-oxobut-3-enyl)cyclobutyl]phenyl]propyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 123560184 |
| Molecular Formula | C33H37N5O3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 2-(2-methoxy-4-morpholin-4-ylanilino)-4-[3-[2-[2-(2-oxobut-3-enyl)cyclobutyl]phenyl]propyl]pyrimidine-5-carbonitrile |
| SMILES | C=CC(=O)CC1CCC1c1ccccc1CCCc1nc(Nc2ccc(N3CCOCC3)cc2OC)ncc1C#N |
| InChI | InChI=1S/C33H37N5O3/c1-3-27(39)19-24-11-13-29(24)28-9-5-4-7-23(28)8-6-10-30-25(21-34)22-35-33(36-30)37-31-14-12-26(20-32(31)40-2)38-15-17-41-18-16-38/h3-5,7,9,12,14,20,22,24,29H,1,6,8,10-11,13,15-19H2,2H3,(H,35,36,37) |
| InChIKey | NRWUYBZDZZDAIO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|