About 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane
1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane (PubChem CID 123569316) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane.
Analyze 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane?
The IUPAC name of 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane (CID 123569316) is 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane.
What is the SMILES notation for 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane?
The canonical SMILES for 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane is CC(C)CC(C)CC1C(C)C1C.
What is the InChIKey of 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane?
The InChIKey is GEDYSLUABYYYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24/c1-8(2)6-9(3)7-12-10(4)11(12)5/h8-12H,6-7H2,1-5H3.
What are the key properties of 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane?
1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane has a molecular weight of 168.32 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylpentyl)-2,3-dimethylcyclopropane is sourced from PubChem (CID 123569316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).