C31H30ClNO7 — CID 123577969
methyl 7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate (PubChem CID 123577969) has the molecular formula C31H30ClNO7 and a molecular weight of 564.03 g/mol. Its IUPAC name is methyl 7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate.
| Compound Name | methyl 7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate |
|---|---|
| PubChem CID | 123577969 |
| Molecular Formula | C31H30ClNO7 |
| Molecular Weight | 564.03 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | methyl 7'-chloro-4',6'-dimethoxy-7-methyl-4-naphthalen-2-yl-3',5-dioxospiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate |
| SMILES | COC(=O)C1CC(c2ccc3ccccc3c2)C2C(=O)CC(C)C3(Oc4c(Cl)c(OC)cc(OC)c4C3=O)C2N1 |
| InChI | InChI=1S/C31H30ClNO7/c1-15-11-21(34)24-19(18-10-9-16-7-5-6-8-17(16)12-18)13-20(30(36)39-4)33-28(24)31(15)29(35)25-22(37-2)14-23(38-3)26(32)27(25)40-31/h5-10,12,14-15,19-20,24,28,33H,11,13H2,1-4H3 |
| InChIKey | HGFXETRTCKQEKZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.03 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |