C23H38B2O4 — CID 123578522
2,9,9-trimethyl-8-propyl-4-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 123578522) has the molecular formula C23H38B2O4 and a molecular weight of 400.18 g/mol. Its IUPAC name is 2,9,9-trimethyl-8-propyl-4-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 2,9,9-trimethyl-8-propyl-4-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 123578522 |
| Molecular Formula | C23H38B2O4 |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 2,9,9-trimethyl-8-propyl-4-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CCCC12CC3OB(B4OC5CC6CC(C6(C)C)C5(C)O4)OC3(C)C(C1)C2(C)C |
| InChI | InChI=1S/C23H38B2O4/c1-8-9-23-12-16(20(23,4)5)22(7)18(13-23)27-25(29-22)24-26-17-11-14-10-15(19(14,2)3)21(17,6)28-24/h14-18H,8-13H2,1-7H3 |
| InChIKey | LHKSWKQYOQSLLL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|