C20H34B2O4 — CID 166142714
(1S,2S,6R,8S)-4-[(3aS,4S,7aR)-3a,4,5,5-tetramethyl-4,6,7,7a-tetrahydrobenzo[d][1,3,2]dioxaborol-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 166142714) has the molecular formula C20H34B2O4 and a molecular weight of 360.11 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-[(3aS,4S,7aR)-3a,4,5,5-tetramethyl-4,6,7,7a-tetrahydrobenzo[d][1,3,2]dioxaborol-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-[(3aS,4S,7aR)-3a,4,5,5-tetramethyl-4,6,7,7a-tetrahydrobenzo[d][1,3,2]dioxaborol-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 166142714 |
| Molecular Formula | C20H34B2O4 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (1S,2S,6R,8S)-4-[(3aS,4S,7aR)-3a,4,5,5-tetramethyl-4,6,7,7a-tetrahydrobenzo[d][1,3,2]dioxaborol-2-yl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C[C@H]1C(C)(C)CC[C@H]2OB(B3O[C@@H]4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)O[C@]21C |
| InChI | InChI=1S/C20H34B2O4/c1-12-17(2,3)9-8-15-19(12,6)25-21(23-15)22-24-16-11-13-10-14(18(13,4)5)20(16,7)26-22/h12-16H,8-11H2,1-7H3/t12-,13-,14-,15+,16+,19-,20-/m0/s1 |
| InChIKey | MZBWQCKWQFOJTL-UNTLWZBDSA-N |
| XLogP | 3.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|