C24H27NO5 — CID 123585799
(2-methylpropan-2-yl)oxycarbonyl 3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylate (PubChem CID 123585799) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 123585799 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)OC(=O)C1(C)CC(Cc2ccc(-c3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C24H27NO5/c1-23(2,3)30-22(28)29-21(27)24(4)15-19(25-20(24)26)14-16-10-12-18(13-11-16)17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3,(H,25,26) |
| InChIKey | WCSDVTMZOKJWCB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|