C9H13N3O5 — CID 123597498
(2,5-dihydroxypyrrol-1-yl) 2,5-diamino-5-oxopentanoate (PubChem CID 123597498) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,5-diamino-5-oxopentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 123597498 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,5-diamino-5-oxopentanoate |
| SMILES | NC(=O)CCC(N)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C9H13N3O5/c10-5(1-2-6(11)13)9(16)17-12-7(14)3-4-8(12)15/h3-5,14-15H,1-2,10H2,(H2,11,13) |
| InChIKey | BZJSESQBEVQDKG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |