C21H24F6N2O6S — CID 123603259
4-[[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-sulfinoamino]methyl]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidine (PubChem CID 123603259) has the molecular formula C21H24F6N2O6S and a molecular weight of 546.49 g/mol. Its IUPAC name is 4-[[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-sulfinoamino]methyl]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidine.
| Compound Name | 4-[[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-sulfinoamino]methyl]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidine |
|---|---|
| PubChem CID | 123603259 |
| Molecular Formula | C21H24F6N2O6S |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 4-[[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-sulfinoamino]methyl]-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidine |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(CN(C2=COC=C(CC3=CC=CCC3)O2)S(=O)O)CC1 |
| InChI | InChI=1S/C21H24F6N2O6S/c22-20(23,24)18(21(25,26)27)35-19(30)28-8-6-15(7-9-28)11-29(36(31)32)17-13-33-12-16(34-17)10-14-4-2-1-3-5-14/h1-2,4,12-13,15,18H,3,5-11H2,(H,31,32) |
| InChIKey | IWWZVLDMICPIGC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|