C20H20F6N2O4S — CID 123142550
1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-4-[[naphthalen-1-yl(sulfino)amino]methyl]piperidine (PubChem CID 123142550) has the molecular formula C20H20F6N2O4S and a molecular weight of 498.45 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-4-[[naphthalen-1-yl(sulfino)amino]methyl]piperidine.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-4-[[naphthalen-1-yl(sulfino)amino]methyl]piperidine |
|---|---|
| PubChem CID | 123142550 |
| Molecular Formula | C20H20F6N2O4S |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-4-[[naphthalen-1-yl(sulfino)amino]methyl]piperidine |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(CN(c2cccc3ccccc23)S(=O)O)CC1 |
| InChI | InChI=1S/C20H20F6N2O4S/c21-19(22,23)17(20(24,25)26)32-18(29)27-10-8-13(9-11-27)12-28(33(30)31)16-7-3-5-14-4-1-2-6-15(14)16/h1-7,13,17H,8-12H2,(H,30,31) |
| InChIKey | OUAIMYKFJAONGU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|