C15H16ClF6N3O4S — CID 89480851
2-chloro-5-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidin-4-yl]methyl-sulfinoamino]pyridine (PubChem CID 89480851) has the molecular formula C15H16ClF6N3O4S and a molecular weight of 483.82 g/mol. Its IUPAC name is 2-chloro-5-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidin-4-yl]methyl-sulfinoamino]pyridine.
| Compound Name | 2-chloro-5-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidin-4-yl]methyl-sulfinoamino]pyridine |
|---|---|
| PubChem CID | 89480851 |
| Molecular Formula | C15H16ClF6N3O4S |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 2-chloro-5-[[1-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperidin-4-yl]methyl-sulfinoamino]pyridine |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC(CN(c2ccc(Cl)nc2)S(=O)O)CC1 |
| InChI | InChI=1S/C15H16ClF6N3O4S/c16-11-2-1-10(7-23-11)25(30(27)28)8-9-3-5-24(6-4-9)13(26)29-12(14(17,18)19)15(20,21)22/h1-2,7,9,12H,3-6,8H2,(H,27,28) |
| InChIKey | YQCSHGFQXVAEIR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|