About 4-methylsilylbutanoic acid
4-methylsilylbutanoic acid (PubChem CID 123603820) has the molecular formula C5H12O2Si
and a molecular weight of 132.24 g/mol. Its IUPAC name is 4-methylsilylbutanoic acid.
Molecular Properties
| Compound Name | 4-methylsilylbutanoic acid |
| PubChem CID | 123603820 |
| Molecular Formula | C5H12O2Si |
| Molecular Weight | 132.24 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 4-methylsilylbutanoic acid |
| SMILES | C[SiH2]CCCC(=O)O |
| InChI | InChI=1S/C5H12O2Si/c1-8-4-2-3-5(6)7/h2-4,8H2,1H3,(H,6,7) |
| InChIKey | YLDGQRFCVBQXOX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsilylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsilylbutanoic acid?
The IUPAC name of 4-methylsilylbutanoic acid (CID 123603820) is 4-methylsilylbutanoic acid.
What is the SMILES notation for 4-methylsilylbutanoic acid?
The canonical SMILES for 4-methylsilylbutanoic acid is C[SiH2]CCCC(=O)O.
What is the InChIKey of 4-methylsilylbutanoic acid?
The InChIKey is YLDGQRFCVBQXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2Si/c1-8-4-2-3-5(6)7/h2-4,8H2,1H3,(H,6,7).
What are the key properties of 4-methylsilylbutanoic acid?
4-methylsilylbutanoic acid has a molecular weight of 132.24 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsilylbutanoic acid is sourced from PubChem (CID 123603820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).