C9H16N2O — CID 123605051
2-(6-methylpiperidin-3-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 123605051) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(6-methylpiperidin-3-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(6-methylpiperidin-3-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 123605051 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(6-methylpiperidin-3-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC1CCC(C2=NCCO2)CN1 |
| InChI | InChI=1S/C9H16N2O/c1-7-2-3-8(6-11-7)9-10-4-5-12-9/h7-8,11H,2-6H2,1H3 |
| InChIKey | RMOYMTMHHYPDPA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |