C14H31N2OSi+ — CID 123631288
dimethyl-[4-(2-methylprop-2-enoylamino)butan-2-yl]-(4-silylbutyl)azanium (PubChem CID 123631288) has the molecular formula C14H31N2OSi+ and a molecular weight of 271.50 g/mol. Its IUPAC name is dimethyl-[4-(2-methylprop-2-enoylamino)butan-2-yl]-(4-silylbutyl)azanium.
| Compound Name | dimethyl-[4-(2-methylprop-2-enoylamino)butan-2-yl]-(4-silylbutyl)azanium |
|---|---|
| PubChem CID | 123631288 |
| Molecular Formula | C14H31N2OSi+ |
| Molecular Weight | 271.50 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | dimethyl-[4-(2-methylprop-2-enoylamino)butan-2-yl]-(4-silylbutyl)azanium |
| SMILES | C=C(C)C(=O)NCCC(C)[N+](C)(C)CCCC[SiH3] |
| InChI | InChI=1S/C14H30N2OSi/c1-12(2)14(17)15-9-8-13(3)16(4,5)10-6-7-11-18/h13H,1,6-11H2,2-5,18H3/p+1 |
| InChIKey | YCIFYIFGVUTNNE-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|