C24H28FNO3 — CID 123633673
(3-fluoro-4-phenylphenyl)methyl 4-(2-oxo-5-propylpyrrolidin-3-yl)butanoate (PubChem CID 123633673) has the molecular formula C24H28FNO3 and a molecular weight of 397.49 g/mol. Its IUPAC name is (3-fluoro-4-phenylphenyl)methyl 4-(2-oxo-5-propylpyrrolidin-3-yl)butanoate.
| Compound Name | (3-fluoro-4-phenylphenyl)methyl 4-(2-oxo-5-propylpyrrolidin-3-yl)butanoate |
|---|---|
| PubChem CID | 123633673 |
| Molecular Formula | C24H28FNO3 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (3-fluoro-4-phenylphenyl)methyl 4-(2-oxo-5-propylpyrrolidin-3-yl)butanoate |
| SMILES | CCCC1CC(CCCC(=O)OCc2ccc(-c3ccccc3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C24H28FNO3/c1-2-7-20-15-19(24(28)26-20)10-6-11-23(27)29-16-17-12-13-21(22(25)14-17)18-8-4-3-5-9-18/h3-5,8-9,12-14,19-20H,2,6-7,10-11,15-16H2,1H3,(H,26,28) |
| InChIKey | ASGPLOHOGOXFPA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |