C16H22N2O3S — CID 123637340
(R)-N-(4,4-dimethyl-7-nitro-3H-naphthalen-1-yl)-2-methylpropane-2-sulfinamide (PubChem CID 123637340) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (R)-N-(4,4-dimethyl-7-nitro-3H-naphthalen-1-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-(4,4-dimethyl-7-nitro-3H-naphthalen-1-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123637340 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (R)-N-(4,4-dimethyl-7-nitro-3H-naphthalen-1-yl)-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)CC=C(N[S@](=O)C(C)(C)C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H22N2O3S/c1-15(2,3)22(21)17-14-8-9-16(4,5)13-7-6-11(18(19)20)10-12(13)14/h6-8,10,17H,9H2,1-5H3/t22-/m1/s1 |
| InChIKey | HNPAQRNABFWXDI-JOCHJYFZSA-N |
| XLogP | 3.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|