C28H57NO8 — CID 123646871
2,4,4-trimethylhexan-2-yl N-[6-ethyl-3,5-dihydroxy-6,8,8-trimethyl-1-(2,3,4-trihydroxybutoxy)nonan-2-yl]carbamate (PubChem CID 123646871) has the molecular formula C28H57NO8 and a molecular weight of 535.76 g/mol. Its IUPAC name is 2,4,4-trimethylhexan-2-yl N-[6-ethyl-3,5-dihydroxy-6,8,8-trimethyl-1-(2,3,4-trihydroxybutoxy)nonan-2-yl]carbamate.
| Compound Name | 2,4,4-trimethylhexan-2-yl N-[6-ethyl-3,5-dihydroxy-6,8,8-trimethyl-1-(2,3,4-trihydroxybutoxy)nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 123646871 |
| Molecular Formula | C28H57NO8 |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.41 |
| IUPAC Name | 2,4,4-trimethylhexan-2-yl N-[6-ethyl-3,5-dihydroxy-6,8,8-trimethyl-1-(2,3,4-trihydroxybutoxy)nonan-2-yl]carbamate |
| SMILES | CCC(C)(C)CC(C)(C)OC(=O)NC(COCC(O)C(O)CO)C(O)CC(O)C(C)(CC)CC(C)(C)C |
| InChI | InChI=1S/C28H57NO8/c1-11-26(6,7)18-27(8,9)37-24(35)29-19(15-36-16-22(33)21(32)14-30)20(31)13-23(34)28(10,12-2)17-25(3,4)5/h19-23,30-34H,11-18H2,1-10H3,(H,29,35) |
| InChIKey | AMSRTEMKBNHVSH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |