C26H54N2O7 — CID 123823204
2,4,4-trimethylpentan-2-yl N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(2,3,4-trihydroxybutylamino)nonan-2-yl]carbamate (PubChem CID 123823204) has the molecular formula C26H54N2O7 and a molecular weight of 506.73 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(2,3,4-trihydroxybutylamino)nonan-2-yl]carbamate.
| Compound Name | 2,4,4-trimethylpentan-2-yl N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(2,3,4-trihydroxybutylamino)nonan-2-yl]carbamate |
|---|---|
| PubChem CID | 123823204 |
| Molecular Formula | C26H54N2O7 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(2,3,4-trihydroxybutylamino)nonan-2-yl]carbamate |
| SMILES | CC(C)(C)CC(C)(C)OC(=O)NC(CNCC(O)C(O)CO)C(O)CC(O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C26H54N2O7/c1-23(2,3)15-25(7,8)21(33)11-18(30)17(12-27-13-19(31)20(32)14-29)28-22(34)35-26(9,10)16-24(4,5)6/h17-21,27,29-33H,11-16H2,1-10H3,(H,28,34) |
| InChIKey | OILIJBLYYVPLLS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |