C8H6Cl2N2OS — CID 123661077
N-[(2,4-dichloro-3-thionitrosophenyl)methyl]formamide (PubChem CID 123661077) has the molecular formula C8H6Cl2N2OS and a molecular weight of 249.12 g/mol. Its IUPAC name is N-[(2,4-dichloro-3-thionitrosophenyl)methyl]formamide.
| Compound Name | N-[(2,4-dichloro-3-thionitrosophenyl)methyl]formamide |
|---|---|
| PubChem CID | 123661077 |
| Molecular Formula | C8H6Cl2N2OS |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | N-[(2,4-dichloro-3-thionitrosophenyl)methyl]formamide |
| SMILES | O=CNCc1ccc(Cl)c(N=S)c1Cl |
| InChI | InChI=1S/C8H6Cl2N2OS/c9-6-2-1-5(3-11-4-13)7(10)8(6)12-14/h1-2,4H,3H2,(H,11,13) |
| InChIKey | WMZJUJYMDIPZHX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|