C8H7NO3 — CID 123681583
6-hydroxy-5,6-dihydropyrano[3,2-b]pyridin-2-one (PubChem CID 123681583) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 6-hydroxy-5,6-dihydropyrano[3,2-b]pyridin-2-one.
| Compound Name | 6-hydroxy-5,6-dihydropyrano[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 123681583 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 6-hydroxy-5,6-dihydropyrano[3,2-b]pyridin-2-one |
| SMILES | O=c1ccc2c(o1)C=CC(O)N2 |
| InChI | InChI=1S/C8H7NO3/c10-7-3-2-6-5(9-7)1-4-8(11)12-6/h1-4,7,9-10H |
| InChIKey | CMLXYLWVYSAVDO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |