C8H9NO — CID 143620073
5-methyl-4,5-dihydrofuro[3,2-b]pyridine (PubChem CID 143620073) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-methyl-4,5-dihydrofuro[3,2-b]pyridine.
| Compound Name | 5-methyl-4,5-dihydrofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 143620073 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 5-methyl-4,5-dihydrofuro[3,2-b]pyridine |
| SMILES | CC1C=Cc2occc2N1 |
| InChI | InChI=1S/C8H9NO/c1-6-2-3-8-7(9-6)4-5-10-8/h2-6,9H,1H3 |
| InChIKey | CFYWFJHTKMEXGV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |