C8H10N2S — CID 123698734
ethane;[1,3]thiazolo[5,4-b]pyridine (PubChem CID 123698734) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is ethane;[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | ethane;[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 123698734 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | ethane;[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC.c1cnc2scnc2c1 |
| InChI | InChI=1S/C6H4N2S.C2H6/c1-2-5-6(7-3-1)9-4-8-5;1-2/h1-4H;1-2H3 |
| InChIKey | DFWMXIKGQVYXGC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |