C20H32N2O4 — CID 123702992
1-[4-(3,4-diethyl-2,5-dihydroxypyrrol-1-yl)butyl]-3,4-diethylpyrrole-2,5-diol (PubChem CID 123702992) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[4-(3,4-diethyl-2,5-dihydroxypyrrol-1-yl)butyl]-3,4-diethylpyrrole-2,5-diol.
| Compound Name | 1-[4-(3,4-diethyl-2,5-dihydroxypyrrol-1-yl)butyl]-3,4-diethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 123702992 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-[4-(3,4-diethyl-2,5-dihydroxypyrrol-1-yl)butyl]-3,4-diethylpyrrole-2,5-diol |
| SMILES | CCc1c(CC)c(O)n(CCCCn2c(O)c(CC)c(CC)c2O)c1O |
| InChI | InChI=1S/C20H32N2O4/c1-5-13-14(6-2)18(24)21(17(13)23)11-9-10-12-22-19(25)15(7-3)16(8-4)20(22)26/h23-26H,5-12H2,1-4H3 |
| InChIKey | AHZZGFAFXCLYSW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|