C26H25Cl3O3 — CID 123719235
(1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2,4,5-trichlorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123719235) has the molecular formula C26H25Cl3O3 and a molecular weight of 491.84 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2,4,5-trichlorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2,4,5-trichlorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123719235 |
| Molecular Formula | C26H25Cl3O3 |
| Molecular Weight | 491.84 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2,4,5-trichlorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@@H]2[C@@H]3O[C@@H](C[C@H]3c3cc(Cl)c(Cl)cc3Cl)[C@@H]2C1=O |
| InChI | InChI=1S/C26H25Cl3O3/c1-4-12-6-11(3)7-13(5-2)20(12)22-24(30)21-19-9-15(26(32-19)23(21)25(22)31)14-8-17(28)18(29)10-16(14)27/h6-8,10,15,19,21-23,26H,4-5,9H2,1-3H3/t15-,19-,21-,22?,23+,26+/m0/s1 |
| InChIKey | VSFPYVZAQBFJNH-BAOASHEQSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|