C26H27NO5 — CID 123776592
(1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123776592) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123776592 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@@H]2[C@@H]3O[C@@H](C[C@H]3c3ccccc3[N+](=O)[O-])[C@@H]2C1=O |
| InChI | InChI=1S/C26H27NO5/c1-4-14-10-13(3)11-15(5-2)20(14)22-24(28)21-19-12-17(26(32-19)23(21)25(22)29)16-8-6-7-9-18(16)27(30)31/h6-11,17,19,21-23,26H,4-5,12H2,1-3H3/t17-,19-,21-,22?,23+,26+/m0/s1 |
| InChIKey | BCCGTEBMXQGULU-BUKZENCBSA-N |
| XLogP | 4.45 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|