C6H8BN2O2P — CID 123721448
ethyl 3-methylidenephosphanyl-4H-1,4,2-diazaborole-5-carboxylate (PubChem CID 123721448) has the molecular formula C6H8BN2O2P and a molecular weight of 181.93 g/mol. Its IUPAC name is ethyl 3-methylidenephosphanyl-4H-1,4,2-diazaborole-5-carboxylate.
| Compound Name | ethyl 3-methylidenephosphanyl-4H-1,4,2-diazaborole-5-carboxylate |
|---|---|
| PubChem CID | 123721448 |
| Molecular Formula | C6H8BN2O2P |
| Molecular Weight | 181.93 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | ethyl 3-methylidenephosphanyl-4H-1,4,2-diazaborole-5-carboxylate |
| SMILES | C=Pc1bnc(C(=O)OCC)[nH]1 |
| InChI | InChI=1S/C6H8BN2O2P/c1-3-11-5(10)4-8-6(12-2)7-9-4/h2-3H2,1H3,(H,8,9) |
| InChIKey | UKZWJZGSNOWPQR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.93 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|