C48H52B2N2 — CID 123727041
[12-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-(2,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borane (PubChem CID 123727041) has the molecular formula C48H52B2N2 and a molecular weight of 678.58 g/mol. Its IUPAC name is [12-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-(2,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borane.
| Compound Name | [12-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-(2,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 123727041 |
| Molecular Formula | C48H52B2N2 |
| Molecular Weight | 678.58 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | [12-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-(2,6-dimethylphenyl)-(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(n2)-c2nc(B(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)ccc2C3(C)C)c2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C48H52B2N2/c1-27-21-32(6)43(33(7)22-27)49(42-30(4)15-14-16-31(42)5)40-19-17-38-46(51-40)47-39(48(38,12)13)18-20-41(52-47)50(44-34(8)23-28(2)24-35(44)9)45-36(10)25-29(3)26-37(45)11/h14-26H,1-13H3 |
| InChIKey | FVKLRUCAWMCJTO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|