C29H34N4O2 — CID 123731877
(Z,2E)-2-[2-(dimethylamino)ethylidene]-5-oxo-N-[(Z)-[1-[(2,3,5,6-tetramethylphenyl)methyl]indol-4-yl]methylideneamino]pent-3-enamide (PubChem CID 123731877) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is (Z,2E)-2-[2-(dimethylamino)ethylidene]-5-oxo-N-[(Z)-[1-[(2,3,5,6-tetramethylphenyl)methyl]indol-4-yl]methylideneamino]pent-3-enamide.
| Compound Name | (Z,2E)-2-[2-(dimethylamino)ethylidene]-5-oxo-N-[(Z)-[1-[(2,3,5,6-tetramethylphenyl)methyl]indol-4-yl]methylideneamino]pent-3-enamide |
|---|---|
| PubChem CID | 123731877 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (Z,2E)-2-[2-(dimethylamino)ethylidene]-5-oxo-N-[(Z)-[1-[(2,3,5,6-tetramethylphenyl)methyl]indol-4-yl]methylideneamino]pent-3-enamide |
| SMILES | Cc1cc(C)c(C)c(Cn2ccc3c(/C=N\NC(=O)C(/C=C\C=O)=C/CN(C)C)cccc32)c1C |
| InChI | InChI=1S/C29H34N4O2/c1-20-17-21(2)23(4)27(22(20)3)19-33-15-13-26-25(9-7-11-28(26)33)18-30-31-29(35)24(10-8-16-34)12-14-32(5)6/h7-13,15-18H,14,19H2,1-6H3,(H,31,35)/b10-8-,24-12+,30-18- |
| InChIKey | APPOWXBXXPWMST-WLCZJTIZSA-N |
| XLogP | 4.62 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|