C24H32N6O — CID 123733541
N'-[3-[2-[3-[4-(aminomethyl)phenyl]-2,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl]cyclohexa-1,5-dien-1-yl]oxypropyl]ethane-1,2-diamine (PubChem CID 123733541) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is N'-[3-[2-[3-[4-(aminomethyl)phenyl]-2,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl]cyclohexa-1,5-dien-1-yl]oxypropyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[2-[3-[4-(aminomethyl)phenyl]-2,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl]cyclohexa-1,5-dien-1-yl]oxypropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123733541 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N'-[3-[2-[3-[4-(aminomethyl)phenyl]-2,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl]cyclohexa-1,5-dien-1-yl]oxypropyl]ethane-1,2-diamine |
| SMILES | NCCNCCCOC1=C(c2cc3c([nH]2)=NCN(c2ccc(CN)cc2)C=3)CCC=C1 |
| InChI | InChI=1S/C24H32N6O/c25-10-12-27-11-3-13-31-23-5-2-1-4-21(23)22-14-19-16-30(17-28-24(19)29-22)20-8-6-18(15-26)7-9-20/h2,5-9,14,16,27H,1,3-4,10-13,15,17,25-26H2,(H,28,29) |
| InChIKey | SGDZDWPRBYLQBJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|