C21H32N2O4S — CID 123753240
O-[4-[[5-(hydroxymethyl)-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-9-yl]oxy]butyl] ethanethioate (PubChem CID 123753240) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is O-[4-[[5-(hydroxymethyl)-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-9-yl]oxy]butyl] ethanethioate.
| Compound Name | O-[4-[[5-(hydroxymethyl)-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-9-yl]oxy]butyl] ethanethioate |
|---|---|
| PubChem CID | 123753240 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | O-[4-[[5-(hydroxymethyl)-1-methyl-3-oxo-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-9-yl]oxy]butyl] ethanethioate |
| SMILES | CC(=S)OCCCCOc1ccc2c(c1)N(C)C(C(C)C)C(=O)NC(CO)C2 |
| InChI | InChI=1S/C21H32N2O4S/c1-14(2)20-21(25)22-17(13-24)11-16-7-8-18(12-19(16)23(20)4)27-10-6-5-9-26-15(3)28/h7-8,12,14,17,20,24H,5-6,9-11,13H2,1-4H3,(H,22,25) |
| InChIKey | ZICGXFQVOCSZPX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|