C17H27N3O3 — CID 177178495
9-(5-aminopentoxy)-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one (PubChem CID 177178495) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 9-(5-aminopentoxy)-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one.
| Compound Name | 9-(5-aminopentoxy)-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
|---|---|
| PubChem CID | 177178495 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 9-(5-aminopentoxy)-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
| SMILES | CN1CC(=O)NC(CO)Cc2ccc(OCCCCCN)cc21 |
| InChI | InChI=1S/C17H27N3O3/c1-20-11-17(22)19-14(12-21)9-13-5-6-15(10-16(13)20)23-8-4-2-3-7-18/h5-6,10,14,21H,2-4,7-9,11-12,18H2,1H3,(H,19,22) |
| InChIKey | TVNMDFIWGXZFCV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|