C19H29BIN2O3- — CID 177178650
CID 177178650 (PubChem CID 177178650) has the molecular formula C19H29BIN2O3- and a molecular weight of 471.17 g/mol.
| Compound Name | CID 177178650 |
|---|---|
| PubChem CID | 177178650 |
| Molecular Formula | C19H29BIN2O3- |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | — |
| SMILES | [B][I-]CCCCOc1ccc2c(c1)N(C)[C@H](C(C)C)C(=O)N[C@@H](CO)C2 |
| InChI | InChI=1S/C19H29BIN2O3/c1-13(2)18-19(25)22-15(12-24)10-14-6-7-16(11-17(14)23(18)3)26-9-5-4-8-21-20/h6-7,11,13,15,18,24H,4-5,8-10,12H2,1-3H3,(H,22,25)/q-1/t15-,18-/m1/s1 |
| InChIKey | PYWPNVDCYSTGGV-CRAIPNDOSA-N |
| XLogP | -1.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|