C18H29N3 — CID 123762788
1-(1H-imidazol-5-yl)-N-[(3-methyl-1-adamantyl)methyl]propan-2-amine (PubChem CID 123762788) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-[(3-methyl-1-adamantyl)methyl]propan-2-amine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-[(3-methyl-1-adamantyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 123762788 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-[(3-methyl-1-adamantyl)methyl]propan-2-amine |
| SMILES | CC(Cc1cnc[nH]1)NCC12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H29N3/c1-13(3-16-9-19-12-21-16)20-11-18-7-14-4-15(8-18)6-17(2,5-14)10-18/h9,12-15,20H,3-8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | AUZMDHIFUOSRJI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |