C17H23BN2O3 — CID 123782822
2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-quinazoline-4,3'-oxetane] (PubChem CID 123782822) has the molecular formula C17H23BN2O3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-quinazoline-4,3'-oxetane].
| Compound Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-quinazoline-4,3'-oxetane] |
|---|---|
| PubChem CID | 123782822 |
| Molecular Formula | C17H23BN2O3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-quinazoline-4,3'-oxetane] |
| SMILES | CC1=NC2(COC2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2N1 |
| InChI | InChI=1S/C17H23BN2O3/c1-11-19-14-8-12(18-22-15(2,3)16(4,5)23-18)6-7-13(14)17(20-11)9-21-10-17/h6-8H,9-10H2,1-5H3,(H,19,20) |
| InChIKey | UUWLFXBPDRWTOB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|