C21H34BN3O2S — CID 144634077
4,4-dimethyl-2-[(2S)-pyrrolidin-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazoline;methanethiol (PubChem CID 144634077) has the molecular formula C21H34BN3O2S and a molecular weight of 403.40 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2S)-pyrrolidin-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazoline;methanethiol.
| Compound Name | 4,4-dimethyl-2-[(2S)-pyrrolidin-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazoline;methanethiol |
|---|---|
| PubChem CID | 144634077 |
| Molecular Formula | C21H34BN3O2S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 4,4-dimethyl-2-[(2S)-pyrrolidin-2-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinazoline;methanethiol |
| SMILES | CC1(C)N=C([C@@H]2CCCN2)Nc2cc(B3OC(C)(C)C(C)(C)O3)ccc21.CS |
| InChI | InChI=1S/C20H30BN3O2.CH4S/c1-18(2)14-10-9-13(21-25-19(3,4)20(5,6)26-21)12-16(14)23-17(24-18)15-8-7-11-22-15;1-2/h9-10,12,15,22H,7-8,11H2,1-6H3,(H,23,24);2H,1H3/t15-;/m0./s1 |
| InChIKey | XZYTYWPVRAXNSC-RSAXXLAASA-N |
| XLogP | 3.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|