C13H20O2 — CID 123797283
5,5-dimethyl-7-(3-methylbuta-1,3-dienyl)-1,6-dioxaspiro[2.5]octane (PubChem CID 123797283) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5,5-dimethyl-7-(3-methylbuta-1,3-dienyl)-1,6-dioxaspiro[2.5]octane.
| Compound Name | 5,5-dimethyl-7-(3-methylbuta-1,3-dienyl)-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 123797283 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 5,5-dimethyl-7-(3-methylbuta-1,3-dienyl)-1,6-dioxaspiro[2.5]octane |
| SMILES | C=C(C)C=CC1CC2(CO2)CC(C)(C)O1 |
| InChI | InChI=1S/C13H20O2/c1-10(2)5-6-11-7-13(9-14-13)8-12(3,4)15-11/h5-6,11H,1,7-9H2,2-4H3 |
| InChIKey | HKQXABBXRJOOEQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|