C21H34O2 — CID 123352694
5,5-dimethyl-7-[3-methyl-5-(4-methylcyclohexyl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane (PubChem CID 123352694) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 5,5-dimethyl-7-[3-methyl-5-(4-methylcyclohexyl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane.
| Compound Name | 5,5-dimethyl-7-[3-methyl-5-(4-methylcyclohexyl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 123352694 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 5,5-dimethyl-7-[3-methyl-5-(4-methylcyclohexyl)penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
| SMILES | CC(C=CC1CC2(CO2)CC(C)(C)O1)=CCC1CCC(C)CC1 |
| InChI | InChI=1S/C21H34O2/c1-16-5-9-18(10-6-16)11-7-17(2)8-12-19-13-21(15-22-21)14-20(3,4)23-19/h7-8,12,16,18-19H,5-6,9-11,13-15H2,1-4H3 |
| InChIKey | WDWGMZSEXMGMPW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|