C22H36B — CID 123803713
CID 123803713 (PubChem CID 123803713) has the molecular formula C22H36B and a molecular weight of 311.34 g/mol.
| Compound Name | CID 123803713 |
|---|---|
| PubChem CID | 123803713 |
| Molecular Formula | C22H36B |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.29 |
| IUPAC Name | — |
| SMILES | C=CC1C#CC(C)=C([B]CC(C)C(C)CC(C)C)CCC1CC |
| InChI | InChI=1S/C22H36B/c1-8-20-11-10-17(5)22(13-12-21(20)9-2)23-15-19(7)18(6)14-16(3)4/h8,16,18-21H,1,9,12-15H2,2-7H3 |
| InChIKey | BTDKKTCUSJGREL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|