C18H28IN7O5 — CID 123808034
(2S)-2-amino-5-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl-(2-iodoethyl)amino]pentanoic acid (PubChem CID 123808034) has the molecular formula C18H28IN7O5 and a molecular weight of 549.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl-(2-iodoethyl)amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl-(2-iodoethyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 123808034 |
| Molecular Formula | C18H28IN7O5 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | (2S)-2-amino-5-[[(2R,4S,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl-(2-iodoethyl)amino]pentanoic acid |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCI)CCC[C@H](N)C(=O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C18H28IN7O5/c1-21-15-12-16(23-8-22-15)26(9-24-12)17-14(28)13(27)11(31-17)7-25(6-4-19)5-2-3-10(20)18(29)30/h8-11,13-14,17,27-28H,2-7,20H2,1H3,(H,29,30)(H,21,22,23)/t10-,11+,13?,14-,17+/m0/s1 |
| InChIKey | NJFZSFILXMRKRL-JJASCPDDSA-N |
| XLogP | -0.58 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|